C25H42O6 — CID 163116219
(1S,6S,9S,13R,15R,17R,19S)-15-hydroxy-9-[(2S)-2-hydroxypropyl]-6,13,19-trimethyl-11-methylidene-8,20-dioxabicyclo[15.2.1]icosane-7,14-dione (PubChem CID 163116219) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is (1S,6S,9S,13R,15R,17R,19S)-15-hydroxy-9-[(2S)-2-hydroxypropyl]-6,13,19-trimethyl-11-methylidene-8,20-dioxabicyclo[15.2.1]icosane-7,14-dione.
| Compound Name | (1S,6S,9S,13R,15R,17R,19S)-15-hydroxy-9-[(2S)-2-hydroxypropyl]-6,13,19-trimethyl-11-methylidene-8,20-dioxabicyclo[15.2.1]icosane-7,14-dione |
|---|---|
| PubChem CID | 163116219 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (1S,6S,9S,13R,15R,17R,19S)-15-hydroxy-9-[(2S)-2-hydroxypropyl]-6,13,19-trimethyl-11-methylidene-8,20-dioxabicyclo[15.2.1]icosane-7,14-dione |
| SMILES | C=C1C[C@@H](C[C@H](C)O)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@@H](C[C@@H](O)C(=O)[C@H](C)C1)C[C@@H]2C |
| InChI | InChI=1S/C25H42O6/c1-15-10-18(4)24(28)22(27)14-21-12-17(3)23(30-21)9-7-6-8-16(2)25(29)31-20(11-15)13-19(5)26/h16-23,26-27H,1,6-14H2,2-5H3/t16-,17-,18+,19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | ZLBUIHOPOZKSFG-WKIZODMRSA-N |
| XLogP | 3.97 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|