C17H33N4+ — CID 163117084
N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine (PubChem CID 163117084) has the molecular formula C17H33N4+ and a molecular weight of 293.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine.
| Compound Name | N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine |
|---|---|
| PubChem CID | 163117084 |
| Molecular Formula | C17H33N4+ |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine |
| SMILES | CN1CCCC/C1=N/C1CC(N(C)C)[NH2+]C2CCCCC12 |
| InChI | InChI=1S/C17H32N4/c1-20(2)17-12-15(13-8-4-5-9-14(13)18-17)19-16-10-6-7-11-21(16)3/h13-15,17-18H,4-12H2,1-3H3/p+1/b19-16- |
| InChIKey | IJDYRJAMBAONAZ-MNDPQUGUSA-O |
| XLogP | 1.28 |
| TPSA | 35.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|