C17H32N4 — CID 163117085
N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine (PubChem CID 163117085) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine.
| Compound Name | N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine |
|---|---|
| PubChem CID | 163117085 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | N,N-dimethyl-4-[(1-methylpiperidin-2-ylidene)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine |
| SMILES | CN1CCCC/C1=N/C1CC(N(C)C)NC2CCCCC12 |
| InChI | InChI=1S/C17H32N4/c1-20(2)17-12-15(13-8-4-5-9-14(13)18-17)19-16-10-6-7-11-21(16)3/h13-15,17-18H,4-12H2,1-3H3/b19-16- |
| InChIKey | IJDYRJAMBAONAZ-MNDPQUGUSA-N |
| XLogP | 2.31 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|