C24H26BrClO6 — CID 163117213
10a-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)oxy-3-chloro-6,8-dihydroxy-2,2-dimethyl-3H-benzo[g]chromene-5,10-dione (PubChem CID 163117213) has the molecular formula C24H26BrClO6 and a molecular weight of 525.82 g/mol. Its IUPAC name is 10a-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)oxy-3-chloro-6,8-dihydroxy-2,2-dimethyl-3H-benzo[g]chromene-5,10-dione.
| Compound Name | 10a-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)oxy-3-chloro-6,8-dihydroxy-2,2-dimethyl-3H-benzo[g]chromene-5,10-dione |
|---|---|
| PubChem CID | 163117213 |
| Molecular Formula | C24H26BrClO6 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 10a-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)oxy-3-chloro-6,8-dihydroxy-2,2-dimethyl-3H-benzo[g]chromene-5,10-dione |
| SMILES | C=C1CCC(Br)C(C)(C)C1OC12OC(C)(C)C(Cl)C=C1C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C24H26BrClO6/c1-11-6-7-16(25)22(2,3)21(11)31-24-14(10-17(26)23(4,5)32-24)19(29)18-13(20(24)30)8-12(27)9-15(18)28/h8-10,16-17,21,27-28H,1,6-7H2,2-5H3 |
| InChIKey | AFSNOWARPBBBDX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|