C33H41N3O11 — CID 163117237
4-[2-[2,8-dimethyl-6-oxo-3-[2,3,4,5,6-pentahydroxy-3-(1H-pyrrolo[3,2-b]pyrrol-4-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one (PubChem CID 163117237) has the molecular formula C33H41N3O11 and a molecular weight of 655.70 g/mol. Its IUPAC name is 4-[2-[2,8-dimethyl-6-oxo-3-[2,3,4,5,6-pentahydroxy-3-(1H-pyrrolo[3,2-b]pyrrol-4-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 4-[2-[2,8-dimethyl-6-oxo-3-[2,3,4,5,6-pentahydroxy-3-(1H-pyrrolo[3,2-b]pyrrol-4-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 163117237 |
| Molecular Formula | C33H41N3O11 |
| Molecular Weight | 655.70 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | 4-[2-[2,8-dimethyl-6-oxo-3-[2,3,4,5,6-pentahydroxy-3-(1H-pyrrolo[3,2-b]pyrrol-4-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one |
| SMILES | Cc1cc(=O)c2cc3c(cc2o1)OC(C)(CCC1CNC(=O)C1)C(OOCC(O)C(O)(Cn1ccc2[nH]ccc21)C(O)C(O)CO)C3 |
| InChI | InChI=1S/C33H41N3O11/c1-18-9-24(38)21-11-20-12-29(32(2,46-26(20)13-27(21)45-18)6-3-19-10-30(41)35-14-19)47-44-16-28(40)33(43,31(42)25(39)15-37)17-36-8-5-22-23(36)4-7-34-22/h4-5,7-9,11,13,19,25,28-29,31,34,37,39-40,42-43H,3,6,10,12,14-17H2,1-2H3,(H,35,41) |
| InChIKey | AGEVGOPKJFWXJA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 208.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.70 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|