C28H32NO6- — CID 163117240
2-[8-[4-[hydroxy(oxido)amino]phenyl]-1,3,5-trimethylspiro[bicyclo[4.2.0]octa-2,4-diene-7,4'-oxolane]-2'-yl]-6-methoxy-3,5-dimethylpyran-4-one (PubChem CID 163117240) has the molecular formula C28H32NO6- and a molecular weight of 478.57 g/mol. Its IUPAC name is 2-[8-[4-[hydroxy(oxido)amino]phenyl]-1,3,5-trimethylspiro[bicyclo[4.2.0]octa-2,4-diene-7,4'-oxolane]-2'-yl]-6-methoxy-3,5-dimethylpyran-4-one.
| Compound Name | 2-[8-[4-[hydroxy(oxido)amino]phenyl]-1,3,5-trimethylspiro[bicyclo[4.2.0]octa-2,4-diene-7,4'-oxolane]-2'-yl]-6-methoxy-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 163117240 |
| Molecular Formula | C28H32NO6- |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 2-[8-[4-[hydroxy(oxido)amino]phenyl]-1,3,5-trimethylspiro[bicyclo[4.2.0]octa-2,4-diene-7,4'-oxolane]-2'-yl]-6-methoxy-3,5-dimethylpyran-4-one |
| SMILES | COc1oc(C2CC3(CO2)C2C(C)=CC(C)=CC2(C)C3c2ccc(N([O-])O)cc2)c(C)c(=O)c1C |
| InChI | InChI=1S/C28H32NO6/c1-15-11-16(2)24-27(5,12-15)25(19-7-9-20(10-8-19)29(31)32)28(24)13-21(34-14-28)23-17(3)22(30)18(4)26(33-6)35-23/h7-12,21,24-25,31H,13-14H2,1-6H3/q-1 |
| InChIKey | GDHTWLWEYXVFTF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|