C35H54O12S — CID 163117799
[6-[[6-(5,5-dimethyloxolan-2-yl)-10-hydroxy-2,6,13,17,17-pentamethyl-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] hydrogen sulfate (PubChem CID 163117799) has the molecular formula C35H54O12S and a molecular weight of 698.87 g/mol. Its IUPAC name is [6-[[6-(5,5-dimethyloxolan-2-yl)-10-hydroxy-2,6,13,17,17-pentamethyl-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] hydrogen sulfate.
| Compound Name | [6-[[6-(5,5-dimethyloxolan-2-yl)-10-hydroxy-2,6,13,17,17-pentamethyl-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 163117799 |
| Molecular Formula | C35H54O12S |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.33 |
| IUPAC Name | [6-[[6-(5,5-dimethyloxolan-2-yl)-10-hydroxy-2,6,13,17,17-pentamethyl-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl]oxy]-4,5-dihydroxyoxan-3-yl] hydrogen sulfate |
| SMILES | CC1(C)CCC(C2(C)OC(=O)C34C(O)C=C5C(CCC6C5(C)CCC(OC5OCC(OS(=O)(=O)O)C(O)C5O)C6(C)C)C3(C)CCC24)O1 |
| InChI | InChI=1S/C35H54O12S/c1-30(2)13-11-25(45-30)34(7)22-10-15-33(6)18-8-9-21-31(3,4)24(44-28-27(38)26(37)20(17-43-28)47-48(40,41)42)12-14-32(21,5)19(18)16-23(36)35(22,33)29(39)46-34/h16,18,20-28,36-38H,8-15,17H2,1-7H3,(H,40,41,42) |
| InChIKey | ALGDYBGONRDVJC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|