About 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide
4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide (PubChem CID 163118514) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide |
| PubChem CID | 163118514 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide |
| SMILES | Cc1cc(C)n(-c2ccc([NH+]([O-])O)cc2)n1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-7-9(2)13(12-8)10-3-5-11(6-4-10)14(15)16/h3-7,14-15H,1-2H3 |
| InChIKey | ARPQGDMDQZJGIS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide?
The IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide (CID 163118514) is 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide.
What is the SMILES notation for 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide?
The canonical SMILES for 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide is Cc1cc(C)n(-c2ccc([NH+]([O-])O)cc2)n1.
What is the InChIKey of 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide?
The InChIKey is ARPQGDMDQZJGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-8-7-9(2)13(12-8)10-3-5-11(6-4-10)14(15)16/h3-7,14-15H,1-2H3.
What are the key properties of 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide?
4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide has a molecular weight of 219.24 g/mol, XLogP of 0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide is sourced from PubChem (CID 163118514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).