C11H13N3O2 — CID 163118514
4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide (PubChem CID 163118514) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163118514 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N-hydroxybenzeneamine oxide |
| SMILES | Cc1cc(C)n(-c2ccc([NH+]([O-])O)cc2)n1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-7-9(2)13(12-8)10-3-5-11(6-4-10)14(15)16/h3-7,14-15H,1-2H3 |
| InChIKey | ARPQGDMDQZJGIS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|