C20H18N2O4-2 — CID 163118665
3-N,3-N-dihydroxy-1-N,1-N-dioxido-4-[2-(2-phenylethyl)phenyl]benzene-1,3-diamine (PubChem CID 163118665) has the molecular formula C20H18N2O4-2 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-N,3-N-dihydroxy-1-N,1-N-dioxido-4-[2-(2-phenylethyl)phenyl]benzene-1,3-diamine.
| Compound Name | 3-N,3-N-dihydroxy-1-N,1-N-dioxido-4-[2-(2-phenylethyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 163118665 |
| Molecular Formula | C20H18N2O4-2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-N,3-N-dihydroxy-1-N,1-N-dioxido-4-[2-(2-phenylethyl)phenyl]benzene-1,3-diamine |
| SMILES | [O-]N([O-])c1ccc(-c2ccccc2CCc2ccccc2)c(N(O)O)c1 |
| InChI | InChI=1S/C20H18N2O4/c23-21(24)17-12-13-19(20(14-17)22(25)26)18-9-5-4-8-16(18)11-10-15-6-2-1-3-7-15/h1-9,12-14,25-26H,10-11H2/q-2 |
| InChIKey | BKOYLNCFVMWMGZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|