C18H36ClN3 — CID 163119211
(4S)-4-N-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 163119211) has the molecular formula C18H36ClN3 and a molecular weight of 329.96 g/mol. Its IUPAC name is (4S)-4-N-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | (4S)-4-N-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 163119211 |
| Molecular Formula | C18H36ClN3 |
| Molecular Weight | 329.96 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | (4S)-4-N-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@H](C)NC1CCNC2CC(Cl)CCC21 |
| InChI | InChI=1S/C18H36ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h14-18,20-21H,4-13H2,1-3H3/t14-,15?,16?,17?,18?/m0/s1 |
| InChIKey | MXSBAWNNHKBQEW-NUVRTYOOSA-N |
| XLogP | 3.22 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.96 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|