C15H25BrClNO2 — CID 163119427
(2S)-2-[(1R)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydrofuro[3,2-c]quinoline (PubChem CID 163119427) has the molecular formula C15H25BrClNO2 and a molecular weight of 366.73 g/mol. Its IUPAC name is (2S)-2-[(1R)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydrofuro[3,2-c]quinoline.
| Compound Name | (2S)-2-[(1R)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 163119427 |
| Molecular Formula | C15H25BrClNO2 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (2S)-2-[(1R)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydrofuro[3,2-c]quinoline |
| SMILES | COC1CCC2NC(C)C3C[C@@H]([C@](C)(Cl)Br)OC3C2C1 |
| InChI | InChI=1S/C15H25BrClNO2/c1-8-10-7-13(15(2,16)17)20-14(10)11-6-9(19-3)4-5-12(11)18-8/h8-14,18H,4-7H2,1-3H3/t8?,9?,10?,11?,12?,13-,14?,15-/m0/s1 |
| InChIKey | WHUIJKNECZYGEK-QXRABXPZSA-N |
| XLogP | 3.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|