C20H25NO12 — CID 163120016
N-hydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzeneamine oxide (PubChem CID 163120016) has the molecular formula C20H25NO12 and a molecular weight of 471.42 g/mol. Its IUPAC name is N-hydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzeneamine oxide.
| Compound Name | N-hydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzeneamine oxide |
|---|---|
| PubChem CID | 163120016 |
| Molecular Formula | C20H25NO12 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-hydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybenzeneamine oxide |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc([NH+]([O-])O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO12/c1-10(22)28-9-16-17(29-11(2)23)18(30-12(3)24)19(31-13(4)25)20(33-16)32-15-7-5-14(6-8-15)21(26)27/h5-8,16-21,26H,9H2,1-4H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | BEPUNLXLWFYBKS-OUUBHVDSSA-N |
| XLogP | -0.45 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|