C25H36O5 — CID 163121034
(2R,4'S,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-6'-hydroxy-4-(hydroxymethyl)-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one (PubChem CID 163121034) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (2R,4'S,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-6'-hydroxy-4-(hydroxymethyl)-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one.
| Compound Name | (2R,4'S,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-6'-hydroxy-4-(hydroxymethyl)-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
|---|---|
| PubChem CID | 163121034 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (2R,4'S,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-6'-hydroxy-4-(hydroxymethyl)-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
| SMILES | CC1=C[C@H]2O[C@]3(C=C(CO)[C@H]2CC1=O)C[C@@](C)(CC1=CC(C)(C)CCC1)C[C@@H](O)O3 |
| InChI | InChI=1S/C25H36O5/c1-16-8-21-19(9-20(16)27)18(14-26)12-25(29-21)15-24(4,13-22(28)30-25)11-17-6-5-7-23(2,3)10-17/h8,10,12,19,21-22,26,28H,5-7,9,11,13-15H2,1-4H3/t19-,21-,22+,24+,25+/m1/s1 |
| InChIKey | BNXDWJTTYJUUGP-KVWZMHGJSA-N |
| XLogP | 4.20 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|