C20H22N3O6- — CID 163121137
4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-(dihydroxyamino)-6-ethoxyphenolate (PubChem CID 163121137) has the molecular formula C20H22N3O6- and a molecular weight of 400.41 g/mol. Its IUPAC name is 4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-(dihydroxyamino)-6-ethoxyphenolate.
| Compound Name | 4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-(dihydroxyamino)-6-ethoxyphenolate |
|---|---|
| PubChem CID | 163121137 |
| Molecular Formula | C20H22N3O6- |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-(dihydroxyamino)-6-ethoxyphenolate |
| SMILES | CCOc1cc([C@H]2C(C#N)=C(N)OC3=C2C(=O)CC(C)(C)C3)cc(N(O)O)c1[O-] |
| InChI | InChI=1S/C20H23N3O6/c1-4-28-14-6-10(5-12(18(14)25)23(26)27)16-11(9-21)19(22)29-15-8-20(2,3)7-13(24)17(15)16/h5-6,16,25-27H,4,7-8,22H2,1-3H3/p-1/t16-/m0/s1 |
| InChIKey | UUYNLESYUWKODH-INIZCTEOSA-M |
| XLogP | 2.19 |
| TPSA | 152.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|