C15H20O4 — CID 163121433
7-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-7-ene-6,9,10-trione (PubChem CID 163121433) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 7-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-7-ene-6,9,10-trione.
| Compound Name | 7-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-7-ene-6,9,10-trione |
|---|---|
| PubChem CID | 163121433 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 7-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-7-ene-6,9,10-trione |
| SMILES | CC1=C(O)C(=O)C2(C(=O)C1=O)C(C)CCC2C(C)C |
| InChI | InChI=1S/C15H20O4/c1-7(2)10-6-5-8(3)15(10)13(18)11(16)9(4)12(17)14(15)19/h7-8,10,16H,5-6H2,1-4H3 |
| InChIKey | BQYFYCLMDKBLPO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|