C24H39NO6 — CID 163121804
4-[(1S)-1-[(2R,3R,5R)-5-[(2R,3R)-4-carboxy-2-ethyl-3-hydroxybutyl]-3-ethyl-5-methyloxolan-2-yl]propyl]-1-methyl-1,2-dihydropyridin-1-ium-3-carboxylate (PubChem CID 163121804) has the molecular formula C24H39NO6 and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-[(1S)-1-[(2R,3R,5R)-5-[(2R,3R)-4-carboxy-2-ethyl-3-hydroxybutyl]-3-ethyl-5-methyloxolan-2-yl]propyl]-1-methyl-1,2-dihydropyridin-1-ium-3-carboxylate.
| Compound Name | 4-[(1S)-1-[(2R,3R,5R)-5-[(2R,3R)-4-carboxy-2-ethyl-3-hydroxybutyl]-3-ethyl-5-methyloxolan-2-yl]propyl]-1-methyl-1,2-dihydropyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 163121804 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 4-[(1S)-1-[(2R,3R,5R)-5-[(2R,3R)-4-carboxy-2-ethyl-3-hydroxybutyl]-3-ethyl-5-methyloxolan-2-yl]propyl]-1-methyl-1,2-dihydropyridin-1-ium-3-carboxylate |
| SMILES | CC[C@@H]1C[C@@](C)(C[C@@H](CC)[C@H](O)CC(=O)O)O[C@H]1[C@@H](CC)C1=C(C(=O)[O-])C[NH+](C)C=C1 |
| InChI | InChI=1S/C24H39NO6/c1-6-15(20(26)11-21(27)28)12-24(4)13-16(7-2)22(31-24)17(8-3)18-9-10-25(5)14-19(18)23(29)30/h9-10,15-17,20,22,26H,6-8,11-14H2,1-5H3,(H,27,28)(H,29,30)/t15-,16-,17+,20-,22-,24-/m1/s1 |
| InChIKey | BUDCZVFMFFVZCK-KKJPJCCSSA-N |
| XLogP | 0.93 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |