C23H31N3O3 — CID 163121835
5-[(benzylamino)methyl]-2-(hydroxymethyl)-4-(4-phenylpiperazin-1-yl)oxolan-3-ol (PubChem CID 163121835) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 5-[(benzylamino)methyl]-2-(hydroxymethyl)-4-(4-phenylpiperazin-1-yl)oxolan-3-ol.
| Compound Name | 5-[(benzylamino)methyl]-2-(hydroxymethyl)-4-(4-phenylpiperazin-1-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 163121835 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 5-[(benzylamino)methyl]-2-(hydroxymethyl)-4-(4-phenylpiperazin-1-yl)oxolan-3-ol |
| SMILES | OCC1OC(CNCc2ccccc2)C(N2CCN(c3ccccc3)CC2)C1O |
| InChI | InChI=1S/C23H31N3O3/c27-17-21-23(28)22(20(29-21)16-24-15-18-7-3-1-4-8-18)26-13-11-25(12-14-26)19-9-5-2-6-10-19/h1-10,20-24,27-28H,11-17H2 |
| InChIKey | BUJBTZYMEZISCX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |