C15H27N3O4 — CID 163122010
methyl (6S)-5-[[5-(hydroxymethyl)oxolan-2-yl]methyl]-3-methyl-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 163122010) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl (6S)-5-[[5-(hydroxymethyl)oxolan-2-yl]methyl]-3-methyl-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | methyl (6S)-5-[[5-(hydroxymethyl)oxolan-2-yl]methyl]-3-methyl-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 163122010 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | methyl (6S)-5-[[5-(hydroxymethyl)oxolan-2-yl]methyl]-3-methyl-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2NCN(C)C2CN1CC1CCC(CO)O1 |
| InChI | InChI=1S/C15H27N3O4/c1-17-9-16-12-5-13(15(20)21-2)18(7-14(12)17)6-10-3-4-11(8-19)22-10/h10-14,16,19H,3-9H2,1-2H3/t10?,11?,12?,13-,14?/m0/s1 |
| InChIKey | MVSMHFIVZHLLBR-PRTVBDMESA-N |
| XLogP | -1.00 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |