C21H38N2O2 — CID 163122635
2-[5-methyl-5-[(2-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydropyrido[3,4-b]indol-2-ium-9-id-1-yl)methyl]oxolan-2-yl]propan-2-ol (PubChem CID 163122635) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2-[5-methyl-5-[(2-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydropyrido[3,4-b]indol-2-ium-9-id-1-yl)methyl]oxolan-2-yl]propan-2-ol.
| Compound Name | 2-[5-methyl-5-[(2-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydropyrido[3,4-b]indol-2-ium-9-id-1-yl)methyl]oxolan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 163122635 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 2-[5-methyl-5-[(2-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydropyrido[3,4-b]indol-2-ium-9-id-1-yl)methyl]oxolan-2-yl]propan-2-ol |
| SMILES | C[NH+]1CCC2C3CCCCC3[N-]C2C1CC1(C)CCC(C(C)(C)O)O1 |
| InChI | InChI=1S/C21H37N2O2/c1-20(2,24)18-9-11-21(3,25-18)13-17-19-15(10-12-23(17)4)14-7-5-6-8-16(14)22-19/h14-19,24H,5-13H2,1-4H3/q-1/p+1 |
| InChIKey | NGJBHGBTGWLFLU-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |