C9H17NO10S3 — CID 163124622
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methylsulfinyl-N-sulfooxyethanimidothioate (PubChem CID 163124622) has the molecular formula C9H17NO10S3 and a molecular weight of 395.43 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methylsulfinyl-N-sulfooxyethanimidothioate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methylsulfinyl-N-sulfooxyethanimidothioate |
|---|---|
| PubChem CID | 163124622 |
| Molecular Formula | C9H17NO10S3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methylsulfinyl-N-sulfooxyethanimidothioate |
| SMILES | CS(=O)CC(=NOS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C9H17NO10S3/c1-22(15)3-5(10-20-23(16,17)18)21-9-8(14)7(13)6(12)4(2-11)19-9/h4,6-9,11-14H,2-3H2,1H3,(H,16,17,18) |
| InChIKey | CUNSBMOUFHIPGQ-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 183.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|