C16H30FN2+ — CID 163124685
1-[(2-fluorocyclohexyl)methyl]-2,7-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium (PubChem CID 163124685) has the molecular formula C16H30FN2+ and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-[(2-fluorocyclohexyl)methyl]-2,7-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium.
| Compound Name | 1-[(2-fluorocyclohexyl)methyl]-2,7-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium |
|---|---|
| PubChem CID | 163124685 |
| Molecular Formula | C16H30FN2+ |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 1-[(2-fluorocyclohexyl)methyl]-2,7-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium |
| SMILES | CC1CCN2CC(C)[NH+](CC3CCCCC3F)C2C1 |
| InChI | InChI=1S/C16H29FN2/c1-12-7-8-18-10-13(2)19(16(18)9-12)11-14-5-3-4-6-15(14)17/h12-16H,3-11H2,1-2H3/p+1 |
| InChIKey | OVBBPHMJRGGPHM-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |