C27H36N3O6+ — CID 163125219
ethyl (2S,5E)-5-[2-(2,3-dihydro-1H-imidazol-1-ium-1-yl)ethylidene]-2-[(1R)-1-hydroxy-1-piperidin-4-ylethyl]-4-methoxy-2,3-dihydrofuro[3,2-g]chromene-7-carboxylate (PubChem CID 163125219) has the molecular formula C27H36N3O6+ and a molecular weight of 498.60 g/mol. Its IUPAC name is ethyl (2S,5E)-5-[2-(2,3-dihydro-1H-imidazol-1-ium-1-yl)ethylidene]-2-[(1R)-1-hydroxy-1-piperidin-4-ylethyl]-4-methoxy-2,3-dihydrofuro[3,2-g]chromene-7-carboxylate.
| Compound Name | ethyl (2S,5E)-5-[2-(2,3-dihydro-1H-imidazol-1-ium-1-yl)ethylidene]-2-[(1R)-1-hydroxy-1-piperidin-4-ylethyl]-4-methoxy-2,3-dihydrofuro[3,2-g]chromene-7-carboxylate |
|---|---|
| PubChem CID | 163125219 |
| Molecular Formula | C27H36N3O6+ |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | ethyl (2S,5E)-5-[2-(2,3-dihydro-1H-imidazol-1-ium-1-yl)ethylidene]-2-[(1R)-1-hydroxy-1-piperidin-4-ylethyl]-4-methoxy-2,3-dihydrofuro[3,2-g]chromene-7-carboxylate |
| SMILES | CCOC(=O)C1=C/C(=C\C[NH+]2C=CNC2)c2c(cc3c(c2OC)C[C@@H]([C@](C)(O)C2CCNCC2)O3)O1 |
| InChI | InChI=1S/C27H35N3O6/c1-4-34-26(31)22-13-17(7-11-30-12-10-29-16-30)24-21(35-22)15-20-19(25(24)33-3)14-23(36-20)27(2,32)18-5-8-28-9-6-18/h7,10,12-13,15,18,23,28-29,32H,4-6,8-9,11,14,16H2,1-3H3/p+1/b17-7+/t23-,27+/m0/s1 |
| InChIKey | DAMRLNDQRNQQFL-UPSDRLRGSA-O |
| XLogP | 0.89 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |