About 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide
3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide (PubChem CID 163125524) has the molecular formula C24H22N2O5
and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide.
Molecular Properties
| Compound Name | 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide |
| PubChem CID | 163125524 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide |
| SMILES | Cc1ccc(C(c2ccc(/N=C/c3cc([NH+]([O-])O)ccc3O)cc2)c2ccc(C)o2)o1 |
| InChI | InChI=1S/C24H22N2O5/c1-15-3-11-22(30-15)24(23-12-4-16(2)31-23)17-5-7-19(8-6-17)25-14-18-13-20(26(28)29)9-10-21(18)27/h3-14,24,26-28H,1-2H3/b25-14+ |
| InChIKey | DDLVBWKAQWVOMV-AFUMVMLFSA-N |
| XLogP | 4.53 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide?
The IUPAC name of 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide (CID 163125524) is 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide.
What is the SMILES notation for 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide?
The canonical SMILES for 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide is Cc1ccc(C(c2ccc(/N=C/c3cc([NH+]([O-])O)ccc3O)cc2)c2ccc(C)o2)o1.
What is the InChIKey of 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide?
The InChIKey is DDLVBWKAQWVOMV-AFUMVMLFSA-N. The full InChI is InChI=1S/C24H22N2O5/c1-15-3-11-22(30-15)24(23-12-4-16(2)31-23)17-5-7-19(8-6-17)25-14-18-13-20(26(28)29)9-10-21(18)27/h3-14,24,26-28H,1-2H3/b25-14+.
What are the key properties of 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide?
3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide has a molecular weight of 418.45 g/mol, XLogP of 4.53, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[bis(5-methylfuran-2-yl)methyl]phenyl]iminomethyl]-N,4-dihydroxybenzeneamine oxide is sourced from PubChem (CID 163125524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).