C17H19N3O2 — CID 163125563
N-hydroxy-4-[(2S,4R)-3,3,10-trimethyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]benzeneamine oxide (PubChem CID 163125563) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-hydroxy-4-[(2S,4R)-3,3,10-trimethyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[(2S,4R)-3,3,10-trimethyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]benzeneamine oxide |
|---|---|
| PubChem CID | 163125563 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-hydroxy-4-[(2S,4R)-3,3,10-trimethyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yl]benzeneamine oxide |
| SMILES | Cc1nc(-c2ccc([NH+]([O-])O)cc2)nc2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C17H19N3O2/c1-9-14-13(8-12-15(14)17(12,2)3)19-16(18-9)10-4-6-11(7-5-10)20(21)22/h4-7,12,15,20-21H,8H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | DDUZZRDEMOLUBP-IUODEOHRSA-N |
| XLogP | 2.15 |
| TPSA | 73.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|