C16H28N3O3- — CID 163125592
1-[3-[hydroxy(oxido)amino]cyclohexyl]-2-(2-methyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone (PubChem CID 163125592) has the molecular formula C16H28N3O3- and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-[3-[hydroxy(oxido)amino]cyclohexyl]-2-(2-methyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone.
| Compound Name | 1-[3-[hydroxy(oxido)amino]cyclohexyl]-2-(2-methyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 163125592 |
| Molecular Formula | C16H28N3O3- |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-[3-[hydroxy(oxido)amino]cyclohexyl]-2-(2-methyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone |
| SMILES | CC1CN2CCCCC2N1CC(=O)C1CCCC(N([O-])O)C1 |
| InChI | InChI=1S/C16H28N3O3/c1-12-10-17-8-3-2-7-16(17)18(12)11-15(20)13-5-4-6-14(9-13)19(21)22/h12-14,16,21H,2-11H2,1H3/q-1 |
| InChIKey | QCVARRIOIBJSNT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|