C18H34N2 — CID 163125678
1-[(3,5-dimethylcyclohexyl)methyl]-2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine (PubChem CID 163125678) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-[(3,5-dimethylcyclohexyl)methyl]-2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine.
| Compound Name | 1-[(3,5-dimethylcyclohexyl)methyl]-2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 163125678 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1-[(3,5-dimethylcyclohexyl)methyl]-2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
| SMILES | CC1CC(C)CC(CN2C(C)CN3CC(C)CCC32)C1 |
| InChI | InChI=1S/C18H34N2/c1-13-5-6-18-19(10-13)11-16(4)20(18)12-17-8-14(2)7-15(3)9-17/h13-18H,5-12H2,1-4H3 |
| InChIKey | OKFDMPNVCAFEFW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |