C20H20N2O8 — CID 163127252
[(1R,2R,3R,4S)-11-hydrazinylidene-1,3,4,5,9,10-hexahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl] acetate (PubChem CID 163127252) has the molecular formula C20H20N2O8 and a molecular weight of 416.39 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-11-hydrazinylidene-1,3,4,5,9,10-hexahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl] acetate.
| Compound Name | [(1R,2R,3R,4S)-11-hydrazinylidene-1,3,4,5,9,10-hexahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl] acetate |
|---|---|
| PubChem CID | 163127252 |
| Molecular Formula | C20H20N2O8 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [(1R,2R,3R,4S)-11-hydrazinylidene-1,3,4,5,9,10-hexahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)[C@H](O)C2=C(c3c(c(O)c4c(O)cccc4c3O)C2=NN)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20N2O8/c1-6(23)30-20(2)18(28)13-11(17(27)19(20)29)10-12(14(13)22-21)16(26)9-7(15(10)25)4-3-5-8(9)24/h3-5,17-19,24-29H,21H2,1-2H3/t17-,18+,19+,20+/m0/s1 |
| InChIKey | BZLZGKDFHXAOQB-MTQWCTHYSA-N |
| XLogP | -0.20 |
| TPSA | 186.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|