C22H26N2O11-2 — CID 163127866
(3S,3aS,6S,6aR)-3,6-bis[2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol (PubChem CID 163127866) has the molecular formula C22H26N2O11-2 and a molecular weight of 494.45 g/mol. Its IUPAC name is (3S,3aS,6S,6aR)-3,6-bis[2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol.
| Compound Name | (3S,3aS,6S,6aR)-3,6-bis[2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol |
|---|---|
| PubChem CID | 163127866 |
| Molecular Formula | C22H26N2O11-2 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (3S,3aS,6S,6aR)-3,6-bis[2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol |
| SMILES | COc1cc([C@H]2OC[C@@]3(O)[C@@H]2CO[C@H]3c2cc(OC)c(OC)cc2N([O-])O)c(N([O-])O)cc1OC |
| InChI | InChI=1S/C22H26N2O11/c1-30-16-5-11(14(23(26)27)7-18(16)32-3)20-13-9-34-21(22(13,25)10-35-20)12-6-17(31-2)19(33-4)8-15(12)24(28)29/h5-8,13,20-21,25-26,28H,9-10H2,1-4H3/q-2/t13-,20-,21+,22-/m1/s1 |
| InChIKey | ZPAPNDODFVUSKS-PPWPQYEESA-N |
| XLogP | 2.30 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|