C57H71N4O7+ — CID 163127903
CID 163127903 (PubChem CID 163127903) has the molecular formula C57H71N4O7+ and a molecular weight of 924.22 g/mol.
| Compound Name | CID 163127903 |
|---|---|
| PubChem CID | 163127903 |
| Molecular Formula | C57H71N4O7+ |
| Molecular Weight | 924.22 g/mol |
| Exact Mass | 923.53 |
| IUPAC Name | — |
| SMILES | CC(O)CNCC1[C+]2C=C(C(O)COc3cc(CC[C-]4C=C(CO)C(CCCCCCC(N)CC5C=Cc6c(ccc7cc8c(cc67)=CCN=8)C5O)[OH+]4)ccc3O)N=C2C2C=CC13CCCC3C2 |
| InChI | InChI=1S/C57H70N4O7/c1-34(63)30-59-31-48-47-29-50(61-55(47)38-18-21-57(48)20-6-7-41(57)24-38)52(65)33-67-54-23-35(11-17-51(54)64)10-14-43-26-40(32-62)53(68-43)9-5-3-2-4-8-42(58)25-39-13-15-44-45(56(39)66)16-12-36-28-49-37(19-22-60-49)27-46(36)44/h11-13,15-19,21,23,26-29,34,38-39,41-42,48,52-53,56,59,62-63,65-66,68H,2-10,14,20,22,24-25,30-33,58H2,1H3/p+1 |
| InChIKey | SSFXXZYGKSSMOX-UHFFFAOYSA-O |
| XLogP | 6.30 |
| TPSA | 185.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.22 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|