C16H25Br2ClO2 — CID 163128665
4,10-dibromo-9-chloro-1-(methoxymethyl)-5,5,9-trimethylspiro[5.5]undec-1-en-3-ol (PubChem CID 163128665) has the molecular formula C16H25Br2ClO2 and a molecular weight of 444.64 g/mol. Its IUPAC name is 4,10-dibromo-9-chloro-1-(methoxymethyl)-5,5,9-trimethylspiro[5.5]undec-1-en-3-ol.
| Compound Name | 4,10-dibromo-9-chloro-1-(methoxymethyl)-5,5,9-trimethylspiro[5.5]undec-1-en-3-ol |
|---|---|
| PubChem CID | 163128665 |
| Molecular Formula | C16H25Br2ClO2 |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 4,10-dibromo-9-chloro-1-(methoxymethyl)-5,5,9-trimethylspiro[5.5]undec-1-en-3-ol |
| SMILES | COCC1=CC(O)C(Br)C(C)(C)C12CCC(C)(Cl)C(Br)C2 |
| InChI | InChI=1S/C16H25Br2ClO2/c1-14(2)13(18)11(20)7-10(9-21-4)16(14)6-5-15(3,19)12(17)8-16/h7,11-13,20H,5-6,8-9H2,1-4H3 |
| InChIKey | FHACEKQZJUCDBT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|