C27H33N3O6 — CID 163129122
4-[1-[4-(dimethylamino)phenyl]-3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4H-pyridin-4-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163129122) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is 4-[1-[4-(dimethylamino)phenyl]-3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4H-pyridin-4-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[1-[4-(dimethylamino)phenyl]-3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4H-pyridin-4-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163129122 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 4-[1-[4-(dimethylamino)phenyl]-3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4H-pyridin-4-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(N(C)C)cc2)C(C)=C(C(=O)OCC)C1c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C27H33N3O6/c1-7-35-26(31)23-17(3)29(21-15-13-20(14-16-21)28(5)6)18(4)24(27(32)36-8-2)25(23)19-9-11-22(12-10-19)30(33)34/h9-16,25,30,33H,7-8H2,1-6H3 |
| InChIKey | FLQDAQBQFXPUPY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|