About 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide
2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide (PubChem CID 163129521) has the molecular formula C10H10N4O3S
and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide.
Molecular Properties
| Compound Name | 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide |
| PubChem CID | 163129521 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide |
| SMILES | [H]/N=c1\sc(C(C)=O)nn1-c1ccccc1[NH+]([O-])O |
| InChI | InChI=1S/C10H10N4O3S/c1-6(15)9-12-13(10(11)18-9)7-4-2-3-5-8(7)14(16)17/h2-5,11,14,16H,1H3/b11-10- |
| InChIKey | FPJYYVXAPALLQZ-KHPPLWFESA-N |
| XLogP | 0.02 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide?
The IUPAC name of 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide (CID 163129521) is 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide.
What is the SMILES notation for 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide?
The canonical SMILES for 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide is [H]/N=c1\sc(C(C)=O)nn1-c1ccccc1[NH+]([O-])O.
What is the InChIKey of 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide?
The InChIKey is FPJYYVXAPALLQZ-KHPPLWFESA-N. The full InChI is InChI=1S/C10H10N4O3S/c1-6(15)9-12-13(10(11)18-9)7-4-2-3-5-8(7)14(16)17/h2-5,11,14,16H,1H3/b11-10-.
What are the key properties of 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide?
2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide has a molecular weight of 266.28 g/mol, XLogP of 0.02, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-acetyl-2-imino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide is sourced from PubChem (CID 163129521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).