C17H12N3O3S- — CID 163130072
(4S)-4-[3-[hydroxy(oxido)amino]phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one (PubChem CID 163130072) has the molecular formula C17H12N3O3S- and a molecular weight of 338.37 g/mol. Its IUPAC name is (4S)-4-[3-[hydroxy(oxido)amino]phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one.
| Compound Name | (4S)-4-[3-[hydroxy(oxido)amino]phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 163130072 |
| Molecular Formula | C17H12N3O3S- |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (4S)-4-[3-[hydroxy(oxido)amino]phenyl]-2-sulfanylidene-3,4-dihydro-1H-indeno[1,2-d]pyrimidin-5-one |
| SMILES | O=C1C2=C(NC(=S)N[C@H]2c2cccc(N([O-])O)c2)c2ccccc21 |
| InChI | InChI=1S/C17H12N3O3S/c21-16-12-7-2-1-6-11(12)15-13(16)14(18-17(24)19-15)9-4-3-5-10(8-9)20(22)23/h1-8,14,22H,(H2,18,19,24)/q-1/t14-/m0/s1 |
| InChIKey | ULMDZZFLMPXXQP-AWEZNQCLSA-N |
| XLogP | 2.51 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|