C30H28O14 — CID 163130341
[(2R,3S,4S,5R,6S)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 163130341) has the molecular formula C30H28O14 and a molecular weight of 612.54 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163130341 |
| Molecular Formula | C30H28O14 |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](OC2=Cc3c(O)cc(O)cc3OC2c2cc(O)c(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H28O14/c31-15-4-1-13(2-5-15)3-6-24(36)41-12-23-26(38)27(39)28(40)30(44-23)43-22-11-17-18(33)9-16(32)10-21(17)42-29(22)14-7-19(34)25(37)20(35)8-14/h1-11,23,26-35,37-40H,12H2/b6-3+/t23-,26-,27+,28-,29?,30-/m1/s1 |
| InChIKey | FXDJICPXMBIKII-BQZOBIETSA-N |
| XLogP | 1.48 |
| TPSA | 236.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|