C21H25NO5 — CID 163130475
1-hydroxy-5-[(2E,4E,6R)-1-hydroxy-4,6-dimethylocta-2,4-dienylidene]-3-(4-hydroxyphenyl)-6-oxo-1,2-dihydropyridin-1-ium-4-olate (PubChem CID 163130475) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-hydroxy-5-[(2E,4E,6R)-1-hydroxy-4,6-dimethylocta-2,4-dienylidene]-3-(4-hydroxyphenyl)-6-oxo-1,2-dihydropyridin-1-ium-4-olate.
| Compound Name | 1-hydroxy-5-[(2E,4E,6R)-1-hydroxy-4,6-dimethylocta-2,4-dienylidene]-3-(4-hydroxyphenyl)-6-oxo-1,2-dihydropyridin-1-ium-4-olate |
|---|---|
| PubChem CID | 163130475 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-hydroxy-5-[(2E,4E,6R)-1-hydroxy-4,6-dimethylocta-2,4-dienylidene]-3-(4-hydroxyphenyl)-6-oxo-1,2-dihydropyridin-1-ium-4-olate |
| SMILES | CC[C@@H](C)/C=C(C)/C=C/C(O)=C1C(=O)[NH+](O)CC(c2ccc(O)cc2)=C1[O-] |
| InChI | InChI=1S/C21H25NO5/c1-4-13(2)11-14(3)5-10-18(24)19-20(25)17(12-22(27)21(19)26)15-6-8-16(23)9-7-15/h5-11,13,23-25,27H,4,12H2,1-3H3/b10-5+,14-11+,19-18?/t13-/m1/s1 |
| InChIKey | PPNWQQKTTGEVCG-XJYYMYHISA-N |
| XLogP | 1.64 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|