C29H48O7S — CID 163131674
[6-hydroxy-17-(2-hydroxy-6-methyl-4-oxoheptan-2-yl)-5,10,13,14-tetramethyl-2,3,4,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 163131674) has the molecular formula C29H48O7S and a molecular weight of 540.76 g/mol. Its IUPAC name is [6-hydroxy-17-(2-hydroxy-6-methyl-4-oxoheptan-2-yl)-5,10,13,14-tetramethyl-2,3,4,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [6-hydroxy-17-(2-hydroxy-6-methyl-4-oxoheptan-2-yl)-5,10,13,14-tetramethyl-2,3,4,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 163131674 |
| Molecular Formula | C29H48O7S |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | [6-hydroxy-17-(2-hydroxy-6-methyl-4-oxoheptan-2-yl)-5,10,13,14-tetramethyl-2,3,4,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | CC(C)CC(=O)CC(C)(O)C1CCC2(C)C3CC(O)C4(C)CC(OS(=O)(=O)O)CCC4(C)C3=CCC12C |
| InChI | InChI=1S/C29H48O7S/c1-18(2)14-19(30)16-29(7,32)23-10-13-26(4)22-15-24(31)28(6)17-20(36-37(33,34)35)8-11-25(28,3)21(22)9-12-27(23,26)5/h9,18,20,22-24,31-32H,8,10-17H2,1-7H3,(H,33,34,35) |
| InChIKey | GJHXGMAZCVOOLT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|