C26H41N5O — CID 163131689
N-[7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8H-purin-6-yl]hydroxylamine (PubChem CID 163131689) has the molecular formula C26H41N5O and a molecular weight of 439.65 g/mol. Its IUPAC name is N-[7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8H-purin-6-yl]hydroxylamine.
| Compound Name | N-[7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8H-purin-6-yl]hydroxylamine |
|---|---|
| PubChem CID | 163131689 |
| Molecular Formula | C26H41N5O |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.33 |
| IUPAC Name | N-[7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8H-purin-6-yl]hydroxylamine |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1CCC(C)=CCN1CN(C)c2ncnc(NO)c21 |
| InChI | InChI=1S/C26H41N5O/c1-18(12-15-31-17-30(6)24-22(31)23(29-32)27-16-28-24)8-10-20-19(2)9-11-21-25(3,4)13-7-14-26(20,21)5/h12,16,20-21,32H,2,7-11,13-15,17H2,1,3-6H3,(H,27,28,29) |
| InChIKey | GJMQQXVKCGNERK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|