C38H41NO10 — CID 163131766
ethyl 3-formyl-9-hydroxy-11-(hydroxymethyl)-5-(3-hydroxypropoxy)-4-[3-(2H-indol-5-yl)-4-oxocyclohexylidene]-9-methyl-6,7,8,9a-tetrahydro-5bH-[1]benzofuro[3,2-g]chromene-2-carboxylate (PubChem CID 163131766) has the molecular formula C38H41NO10 and a molecular weight of 671.74 g/mol. Its IUPAC name is ethyl 3-formyl-9-hydroxy-11-(hydroxymethyl)-5-(3-hydroxypropoxy)-4-[3-(2H-indol-5-yl)-4-oxocyclohexylidene]-9-methyl-6,7,8,9a-tetrahydro-5bH-[1]benzofuro[3,2-g]chromene-2-carboxylate.
| Compound Name | ethyl 3-formyl-9-hydroxy-11-(hydroxymethyl)-5-(3-hydroxypropoxy)-4-[3-(2H-indol-5-yl)-4-oxocyclohexylidene]-9-methyl-6,7,8,9a-tetrahydro-5bH-[1]benzofuro[3,2-g]chromene-2-carboxylate |
|---|---|
| PubChem CID | 163131766 |
| Molecular Formula | C38H41NO10 |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.27 |
| IUPAC Name | ethyl 3-formyl-9-hydroxy-11-(hydroxymethyl)-5-(3-hydroxypropoxy)-4-[3-(2H-indol-5-yl)-4-oxocyclohexylidene]-9-methyl-6,7,8,9a-tetrahydro-5bH-[1]benzofuro[3,2-g]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(C=O)C(=C2CCC(=O)C(c3ccc4c(c3)=CCN=4)C2)c2c(c(CO)c3c(c2OCCCO)C2CCCC(C)(O)C2O3)O1 |
| InChI | InChI=1S/C38H41NO10/c1-3-46-37(44)34-25(18-41)29(22-8-10-28(43)24(17-22)20-7-9-27-21(16-20)11-13-39-27)31-33(48-34)26(19-42)32-30(35(31)47-15-5-14-40)23-6-4-12-38(2,45)36(23)49-32/h7,9,11,16,18,23-24,36,40,42,45H,3-6,8,10,12-15,17,19H2,1-2H3 |
| InChIKey | GKBRVQFRYGZEHY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|