C19H25N2O5- — CID 163132044
(1R,5R)-2-[1-[[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one (PubChem CID 163132044) has the molecular formula C19H25N2O5- and a molecular weight of 361.42 g/mol. Its IUPAC name is (1R,5R)-2-[1-[[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one.
| Compound Name | (1R,5R)-2-[1-[[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 163132044 |
| Molecular Formula | C19H25N2O5- |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (1R,5R)-2-[1-[[(1R,2R)-1,3-dihydroxy-1-[4-[hydroxy(oxido)amino]phenyl]propan-2-yl]amino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
| SMILES | CC(N[C@H](CO)[C@H](O)c1ccc(N([O-])O)cc1)=C1C(=O)C[C@@H]2[C@@H]1C2(C)C |
| InChI | InChI=1S/C19H25N2O5/c1-10(16-15(23)8-13-17(16)19(13,2)3)20-14(9-22)18(24)11-4-6-12(7-5-11)21(25)26/h4-7,13-14,17-18,20,22,24-25H,8-9H2,1-3H3/q-1/t13-,14-,17+,18-/m1/s1 |
| InChIKey | WSEAGKGYLGBJFS-KJWYOANISA-N |
| XLogP | 1.88 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|