C18H24O8 — CID 163132154
[(1S,2R,3S,6S,7R,8R,11S)-8-hydroxy-6-methoxy-3,7,11-trimethyl-4,13-dioxo-5,12-dioxatetracyclo[6.6.0.01,11.03,7]tetradecan-2-yl] acetate (PubChem CID 163132154) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is [(1S,2R,3S,6S,7R,8R,11S)-8-hydroxy-6-methoxy-3,7,11-trimethyl-4,13-dioxo-5,12-dioxatetracyclo[6.6.0.01,11.03,7]tetradecan-2-yl] acetate.
| Compound Name | [(1S,2R,3S,6S,7R,8R,11S)-8-hydroxy-6-methoxy-3,7,11-trimethyl-4,13-dioxo-5,12-dioxatetracyclo[6.6.0.01,11.03,7]tetradecan-2-yl] acetate |
|---|---|
| PubChem CID | 163132154 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(1S,2R,3S,6S,7R,8R,11S)-8-hydroxy-6-methoxy-3,7,11-trimethyl-4,13-dioxo-5,12-dioxatetracyclo[6.6.0.01,11.03,7]tetradecan-2-yl] acetate |
| SMILES | CO[C@H]1OC(=O)[C@]2(C)[C@H](OC(C)=O)[C@]34CC(=O)O[C@@]3(C)CC[C@]4(O)[C@]12C |
| InChI | InChI=1S/C18H24O8/c1-9(19)24-11-15(3)12(21)25-13(23-5)16(15,4)18(22)7-6-14(2)17(11,18)8-10(20)26-14/h11,13,22H,6-8H2,1-5H3/t11-,13-,14-,15-,16+,17+,18-/m0/s1 |
| InChIKey | GNYSLQWVMYNWSW-MUDOUTQQSA-N |
| XLogP | 0.69 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|