C18H24N6O4 — CID 163132308
4-[(2S,3R)-3-(diaminomethylamino)-6-[(E)-2-(diaminomethylamino)ethenyl]-2,3-dihydro-1,4-benzodioxin-2-yl]benzene-1,2-diol (PubChem CID 163132308) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[(2S,3R)-3-(diaminomethylamino)-6-[(E)-2-(diaminomethylamino)ethenyl]-2,3-dihydro-1,4-benzodioxin-2-yl]benzene-1,2-diol.
| Compound Name | 4-[(2S,3R)-3-(diaminomethylamino)-6-[(E)-2-(diaminomethylamino)ethenyl]-2,3-dihydro-1,4-benzodioxin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 163132308 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[(2S,3R)-3-(diaminomethylamino)-6-[(E)-2-(diaminomethylamino)ethenyl]-2,3-dihydro-1,4-benzodioxin-2-yl]benzene-1,2-diol |
| SMILES | NC(N)N/C=C/c1ccc2c(c1)O[C@@H](NC(N)N)[C@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C18H24N6O4/c19-17(20)23-6-5-9-1-4-13-14(7-9)28-16(24-18(21)22)15(27-13)10-2-3-11(25)12(26)8-10/h1-8,15-18,23-26H,19-22H2/b6-5+/t15-,16+/m0/s1 |
| InChIKey | GPNWOKSKODULFA-DZEZYYDTSA-N |
| XLogP | -0.51 |
| TPSA | 187.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|