C14H20N2O10 — CID 163133553
4,6-bis(2-acetyloxyethoxy)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 163133553) has the molecular formula C14H20N2O10 and a molecular weight of 376.32 g/mol. Its IUPAC name is 4,6-bis(2-acetyloxyethoxy)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4,6-bis(2-acetyloxyethoxy)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163133553 |
| Molecular Formula | C14H20N2O10 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4,6-bis(2-acetyloxyethoxy)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | CC(=O)OCCOc1cc(OCCOC(C)=O)c([NH+]([O-])O)cc1[NH+]([O-])O |
| InChI | InChI=1S/C14H20N2O10/c1-9(17)23-3-5-25-13-8-14(26-6-4-24-10(2)18)12(16(21)22)7-11(13)15(19)20/h7-8,15-16,19,21H,3-6H2,1-2H3 |
| InChIKey | HBFJCDZSIJSLFC-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 166.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|