C41H72N6O6S2 — CID 163133794
[10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,37-dihydroxy-4-oxo-35-oxa-13,14-dithia-3,9,11-triazapentacyclo[24.11.1.13,6.027,36.030,34]nonatriacont-10-en-23-yl] acetate (PubChem CID 163133794) has the molecular formula C41H72N6O6S2 and a molecular weight of 809.20 g/mol. Its IUPAC name is [10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,37-dihydroxy-4-oxo-35-oxa-13,14-dithia-3,9,11-triazapentacyclo[24.11.1.13,6.027,36.030,34]nonatriacont-10-en-23-yl] acetate.
| Compound Name | [10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,37-dihydroxy-4-oxo-35-oxa-13,14-dithia-3,9,11-triazapentacyclo[24.11.1.13,6.027,36.030,34]nonatriacont-10-en-23-yl] acetate |
|---|---|
| PubChem CID | 163133794 |
| Molecular Formula | C41H72N6O6S2 |
| Molecular Weight | 809.20 g/mol |
| Exact Mass | 808.50 |
| IUPAC Name | [10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,37-dihydroxy-4-oxo-35-oxa-13,14-dithia-3,9,11-triazapentacyclo[24.11.1.13,6.027,36.030,34]nonatriacont-10-en-23-yl] acetate |
| SMILES | CC(=O)OC1CCC2CC(CN3CC(CC4CCNC(N)C4)(CCNC(N)=NCSSCCCCCCC(O)C1)CC3=O)C(O)C1OC3CCCC3CCC21 |
| InChI | InChI=1S/C41H72N6O6S2/c1-27(48)52-33-12-10-30-20-31(38(51)39-34(30)13-11-29-7-6-9-35(29)53-39)24-47-25-41(23-37(47)50,22-28-14-16-44-36(42)19-28)15-17-45-40(43)46-26-55-54-18-5-3-2-4-8-32(49)21-33/h28-36,38-39,44,49,51H,2-26,42H2,1H3,(H3,43,45,46) |
| InChIKey | NIOFNIBJFFDLAR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 184.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|