C37H68N6O6S2+2 — CID 163134119
[10-amino-6-[(2-aminopiperidin-1-ium-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9-diaza-11-azoniatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate (PubChem CID 163134119) has the molecular formula C37H68N6O6S2+2 and a molecular weight of 757.12 g/mol. Its IUPAC name is [10-amino-6-[(2-aminopiperidin-1-ium-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9-diaza-11-azoniatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate.
| Compound Name | [10-amino-6-[(2-aminopiperidin-1-ium-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9-diaza-11-azoniatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate |
|---|---|
| PubChem CID | 163134119 |
| Molecular Formula | C37H68N6O6S2+2 |
| Molecular Weight | 757.12 g/mol |
| Exact Mass | 756.46 |
| IUPAC Name | [10-amino-6-[(2-aminopiperidin-1-ium-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9-diaza-11-azoniatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate |
| SMILES | CC(=O)OC1CCC2CC(CN3CC(CC4CC[NH2+]C(N)C4)(CCNC(N)=[NH+]CSSCCCCCCC(O)C1)CC3=O)C(O)C1OCCCC21 |
| InChI | InChI=1S/C37H66N6O6S2/c1-25(44)49-30-10-9-27-18-28(34(47)35-31(27)8-6-15-48-35)22-43-23-37(21-33(43)46,20-26-11-13-40-32(38)17-26)12-14-41-36(39)42-24-51-50-16-5-3-2-4-7-29(45)19-30/h26-32,34-35,40,45,47H,2-24,38H2,1H3,(H3,39,41,42)/p+2 |
| InChIKey | SKINFZIOCLHYSQ-UHFFFAOYSA-P |
| XLogP | 0.79 |
| TPSA | 190.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.12 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|