C37H66N6O6S2 — CID 163134122
[(6R,21S,23S)-10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9,11-triazatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate (PubChem CID 163134122) has the molecular formula C37H66N6O6S2 and a molecular weight of 755.10 g/mol. Its IUPAC name is [(6R,21S,23S)-10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9,11-triazatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate.
| Compound Name | [(6R,21S,23S)-10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9,11-triazatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate |
|---|---|
| PubChem CID | 163134122 |
| Molecular Formula | C37H66N6O6S2 |
| Molecular Weight | 755.10 g/mol |
| Exact Mass | 754.45 |
| IUPAC Name | [(6R,21S,23S)-10-amino-6-[(2-aminopiperidin-4-yl)methyl]-21,33-dihydroxy-4-oxo-31-oxa-13,14-dithia-3,9,11-triazatetracyclo[24.7.1.13,6.027,32]pentatriacont-10-en-23-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2CC(CN3C[C@](CC4CCNC(N)C4)(CCNC(N)=NCSSCCCCCC[C@H](O)C1)CC3=O)C(O)C1OCCCC21 |
| InChI | InChI=1S/C37H66N6O6S2/c1-25(44)49-30-10-9-27-18-28(34(47)35-31(27)8-6-15-48-35)22-43-23-37(21-33(43)46,20-26-11-13-40-32(38)17-26)12-14-41-36(39)42-24-51-50-16-5-3-2-4-7-29(45)19-30/h26-32,34-35,40,45,47H,2-24,38H2,1H3,(H3,39,41,42)/t26?,27?,28?,29-,30-,31?,32?,34?,35?,37-/m0/s1 |
| InChIKey | SKINFZIOCLHYSQ-NDEHKFGOSA-N |
| XLogP | 3.73 |
| TPSA | 184.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.10 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|