C23H31NO10 — CID 163134262
(2S,3R,4S)-3-ethenyl-4-[(E)-2-[1-(2-hydroxyethyl)-2H-pyridin-5-yl]ethenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid (PubChem CID 163134262) has the molecular formula C23H31NO10 and a molecular weight of 481.50 g/mol. Its IUPAC name is (2S,3R,4S)-3-ethenyl-4-[(E)-2-[1-(2-hydroxyethyl)-2H-pyridin-5-yl]ethenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid.
| Compound Name | (2S,3R,4S)-3-ethenyl-4-[(E)-2-[1-(2-hydroxyethyl)-2H-pyridin-5-yl]ethenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid |
|---|---|
| PubChem CID | 163134262 |
| Molecular Formula | C23H31NO10 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (2S,3R,4S)-3-ethenyl-4-[(E)-2-[1-(2-hydroxyethyl)-2H-pyridin-5-yl]ethenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid |
| SMILES | C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C(C(=O)O)[C@H]1/C=C/C1=CN(CCO)CC=C1 |
| InChI | InChI=1S/C23H31NO10/c1-2-14-15(6-5-13-4-3-7-24(10-13)8-9-25)16(21(30)31)12-32-22(14)34-23-20(29)19(28)18(27)17(11-26)33-23/h2-6,10,12,14-15,17-20,22-23,25-29H,1,7-9,11H2,(H,30,31)/b6-5+/t14-,15+,17-,18-,19+,20-,22+,23+/m1/s1 |
| InChIKey | HIGJHZUFMLQPDX-YLCGFITOSA-N |
| XLogP | -1.15 |
| TPSA | 169.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|