C16H29FN2 — CID 163135186
1-[(3-fluorocyclohexyl)methyl]-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine (PubChem CID 163135186) has the molecular formula C16H29FN2 and a molecular weight of 268.42 g/mol. Its IUPAC name is 1-[(3-fluorocyclohexyl)methyl]-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine.
| Compound Name | 1-[(3-fluorocyclohexyl)methyl]-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 163135186 |
| Molecular Formula | C16H29FN2 |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 1-[(3-fluorocyclohexyl)methyl]-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
| SMILES | CC1CCCN2CC(C)N(CC3CCCC(F)C3)C12 |
| InChI | InChI=1S/C16H29FN2/c1-12-5-4-8-18-10-13(2)19(16(12)18)11-14-6-3-7-15(17)9-14/h12-16H,3-11H2,1-2H3 |
| InChIKey | WSCOFVOMNCNTKR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |