C18H26N2O7 — CID 163135207
1-N,3-N-dihydroxy-5-[[(3R,4R)-4-methoxy-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxycarbonyl]benzene-1,3-diamine oxide (PubChem CID 163135207) has the molecular formula C18H26N2O7 and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-N,3-N-dihydroxy-5-[[(3R,4R)-4-methoxy-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxycarbonyl]benzene-1,3-diamine oxide.
| Compound Name | 1-N,3-N-dihydroxy-5-[[(3R,4R)-4-methoxy-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxycarbonyl]benzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163135207 |
| Molecular Formula | C18H26N2O7 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-N,3-N-dihydroxy-5-[[(3R,4R)-4-methoxy-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxycarbonyl]benzene-1,3-diamine oxide |
| SMILES | CO[C@@H]1CC2C(C[C@@]1(C)OC(=O)c1cc([NH+]([O-])O)cc([NH+]([O-])O)c1)C2(C)C |
| InChI | InChI=1S/C18H26N2O7/c1-17(2)13-8-15(26-4)18(3,9-14(13)17)27-16(21)10-5-11(19(22)23)7-12(6-10)20(24)25/h5-7,13-15,19-20,22,24H,8-9H2,1-4H3/t13?,14?,15-,18-/m1/s1 |
| InChIKey | HRHZDLOTHSOORB-PPPKJHQXSA-N |
| XLogP | 0.49 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|