About 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide
2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide (PubChem CID 163136048) has the molecular formula C17H15N3O4
and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide.
Molecular Properties
| Compound Name | 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide |
| PubChem CID | 163136048 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide |
| SMILES | O=C1C/C(=N\CCc2cc([NH+]([O-])O)ccn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H15N3O4/c21-16-10-15(17(22)14-4-2-1-3-13(14)16)19-7-5-11-9-12(20(23)24)6-8-18-11/h1-4,6,8-9,20,23H,5,7,10H2/b19-15+ |
| InChIKey | HZHFEFQRDDHLTL-XDJHFCHBSA-N |
| XLogP | 0.94 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide?
The IUPAC name of 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide (CID 163136048) is 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide.
What is the SMILES notation for 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide?
The canonical SMILES for 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide is O=C1C/C(=N\CCc2cc([NH+]([O-])O)ccn2)C(=O)c2ccccc21.
What is the InChIKey of 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide?
The InChIKey is HZHFEFQRDDHLTL-XDJHFCHBSA-N. The full InChI is InChI=1S/C17H15N3O4/c21-16-10-15(17(22)14-4-2-1-3-13(14)16)19-7-5-11-9-12(20(23)24)6-8-18-11/h1-4,6,8-9,20,23H,5,7,10H2/b19-15+.
What are the key properties of 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide?
2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide has a molecular weight of 325.32 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1,4-dioxonaphthalen-2-ylidene)amino]ethyl]-N-hydroxypyridin-4-amine oxide is sourced from PubChem (CID 163136048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).