C21H24ClN2O- — CID 163136321
[(3R,4R,5R,7R)-5-chloro-4-ethenyl-4,8,8-trimethyl-15-oxo-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1,9(16),10,12-tetraen-3-yl]-methylazanide (PubChem CID 163136321) has the molecular formula C21H24ClN2O- and a molecular weight of 355.89 g/mol. Its IUPAC name is [(3R,4R,5R,7R)-5-chloro-4-ethenyl-4,8,8-trimethyl-15-oxo-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1,9(16),10,12-tetraen-3-yl]-methylazanide.
| Compound Name | [(3R,4R,5R,7R)-5-chloro-4-ethenyl-4,8,8-trimethyl-15-oxo-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1,9(16),10,12-tetraen-3-yl]-methylazanide |
|---|---|
| PubChem CID | 163136321 |
| Molecular Formula | C21H24ClN2O- |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [(3R,4R,5R,7R)-5-chloro-4-ethenyl-4,8,8-trimethyl-15-oxo-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1,9(16),10,12-tetraen-3-yl]-methylazanide |
| SMILES | C=C[C@@]1(C)[C@H](Cl)C[C@H]2C(=C3C(=O)Nc4cccc(c43)C2(C)C)[C@H]1[N-]C |
| InChI | InChI=1S/C21H24ClN2O/c1-6-21(4)14(22)10-12-16(18(21)23-5)17-15-11(20(12,2)3)8-7-9-13(15)24-19(17)25/h6-9,12,14,18H,1,10H2,2-5H3,(H,24,25)/q-1/t12-,14+,18+,21-/m0/s1 |
| InChIKey | COQFPTGDFXRIPT-FWKFCYAVSA-N |
| XLogP | 4.88 |
| TPSA | 43.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|